C20H32IN7 — CID 111795640
1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111795640) has the molecular formula C20H32IN7 and a molecular weight of 497.43 g/mol. Its IUPAC name is 1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111795640 |
| Molecular Formula | C20H32IN7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-ethyl-3-(1-propan-2-ylpiperidin-4-yl)-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)NC1CCN(C(C)C)CC1.I |
| InChI | InChI=1S/C20H31N7.HI/c1-4-21-20(25-18-8-10-27(11-9-18)15(2)3)22-13-16-6-5-7-17(12-16)19-23-14-24-26-19;/h5-7,12,14-15,18H,4,8-11,13H2,1-3H3,(H2,21,22,25)(H,23,24,26);1H |
| InChIKey | KXZAKOZPEXILQG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|