C19H23IN6S — CID 111797106
2-methyl-1-(2-phenylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111797106) has the molecular formula C19H23IN6S and a molecular weight of 494.41 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111797106 |
| Molecular Formula | C19H23IN6S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSc1ccccc1)NCc1cccc(-c2ncn[nH]2)c1.I |
| InChI | InChI=1S/C19H22N6S.HI/c1-20-19(21-10-11-26-17-8-3-2-4-9-17)22-13-15-6-5-7-16(12-15)18-23-14-24-25-18;/h2-9,12,14H,10-11,13H2,1H3,(H2,20,21,22)(H,23,24,25);1H |
| InChIKey | GVHCSWBCLXIKRE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|