C20H21F3N6 — CID 111795392
2-methyl-1-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111795392) has the molecular formula C20H21F3N6 and a molecular weight of 402.42 g/mol. Its IUPAC name is 2-methyl-1-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111795392 |
| Molecular Formula | C20H21F3N6 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-methyl-1-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(C(F)(F)F)cc1)NCc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C20H21F3N6/c1-24-19(25-10-9-14-5-7-17(8-6-14)20(21,22)23)26-12-15-3-2-4-16(11-15)18-27-13-28-29-18/h2-8,11,13H,9-10,12H2,1H3,(H2,24,25,26)(H,27,28,29) |
| InChIKey | JXAZHXURIXRORW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|