C25H26N6 — CID 111796619
1-(2,2-diphenylethyl)-2-methyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111796619) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-2-methyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111796619 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(-c2ncn[nH]2)c1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N6/c1-26-25(27-16-19-9-8-14-22(15-19)24-29-18-30-31-24)28-17-23(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-15,18,23H,16-17H2,1H3,(H2,26,27,28)(H,29,30,31) |
| InChIKey | KCEYRTOJUXNWAA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|