C24H26N4O — CID 111357348
3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111357348) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111357348 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(N)=O)c1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O/c1-26-24(27-16-18-9-8-14-21(15-18)23(25)29)28-17-22(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-15,22H,16-17H2,1H3,(H2,25,29)(H2,26,27,28) |
| InChIKey | ATVTZVKROUZXPZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|