C14H21IN6S — CID 111796324
2-methyl-1-(2-methylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111796324) has the molecular formula C14H21IN6S and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111796324 |
| Molecular Formula | C14H21IN6S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylethyl)-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCc1cccc(-c2ncn[nH]2)c1.I |
| InChI | InChI=1S/C14H20N6S.HI/c1-15-14(16-6-7-21-2)17-9-11-4-3-5-12(8-11)13-18-10-19-20-13;/h3-5,8,10H,6-7,9H2,1-2H3,(H2,15,16,17)(H,18,19,20);1H |
| InChIKey | IUHHKVFYZQISCD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|