C23H36IN7 — CID 111795370
2-methyl-1-[(1-piperidin-1-ylcyclohexyl)methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111795370) has the molecular formula C23H36IN7 and a molecular weight of 537.49 g/mol. Its IUPAC name is 2-methyl-1-[(1-piperidin-1-ylcyclohexyl)methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(1-piperidin-1-ylcyclohexyl)methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111795370 |
| Molecular Formula | C23H36IN7 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-methyl-1-[(1-piperidin-1-ylcyclohexyl)methyl]-3-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(-c2ncn[nH]2)c1)NCC1(N2CCCCC2)CCCCC1.I |
| InChI | InChI=1S/C23H35N7.HI/c1-24-22(25-16-19-9-8-10-20(15-19)21-27-18-28-29-21)26-17-23(11-4-2-5-12-23)30-13-6-3-7-14-30;/h8-10,15,18H,2-7,11-14,16-17H2,1H3,(H2,24,25,26)(H,27,28,29);1H |
| InChIKey | PXXWLHWKQXAJCK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|