C20H23ClN6S — CID 111372341
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111372341) has the molecular formula C20H23ClN6S and a molecular weight of 414.97 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111372341 |
| Molecular Formula | C20H23ClN6S |
| Molecular Weight | 414.97 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2cccn2)c1)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN6S/c1-2-22-20(24-11-13-28-18-6-4-17(21)5-7-18)25-15-16-8-10-23-19(14-16)27-12-3-9-26-27/h3-10,12,14H,2,11,13,15H2,1H3,(H2,22,24,25) |
| InChIKey | IQVYCXFPDFTYDX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.97 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|