C18H26N6 — CID 110956930
1-cyclohexyl-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 110956930) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 110956930 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 1-cyclohexyl-3-ethyl-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2cccn2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C18H26N6/c1-2-19-18(23-16-7-4-3-5-8-16)21-14-15-9-11-20-17(13-15)24-12-6-10-22-24/h6,9-13,16H,2-5,7-8,14H2,1H3,(H2,19,21,23) |
| InChIKey | DBSYVKPEKLYNPM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|