C21H26N6 — CID 111199246
1-ethyl-3-(3-phenylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111199246) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-ethyl-3-(3-phenylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-phenylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111199246 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-ethyl-3-(3-phenylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2cccn2)c1)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H26N6/c1-2-22-21(24-12-6-10-18-8-4-3-5-9-18)25-17-19-11-14-23-20(16-19)27-15-7-13-26-27/h3-5,7-9,11,13-16H,2,6,10,12,17H2,1H3,(H2,22,24,25) |
| InChIKey | CTIJSVZBBOUYGS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|