C21H26Cl2N4O2 — CID 109492724
4-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide (PubChem CID 109492724) has the molecular formula C21H26Cl2N4O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is 4-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide.
| Compound Name | 4-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 109492724 |
| Molecular Formula | C21H26Cl2N4O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(C/N=C(\NCC)NCC(O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H26Cl2N4O2/c1-3-24-20(29)15-7-5-14(6-8-15)12-26-21(25-4-2)27-13-19(28)16-9-17(22)11-18(23)10-16/h5-11,19,28H,3-4,12-13H2,1-2H3,(H,24,29)(H2,25,26,27) |
| InChIKey | YDAJDQUSGRASBZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|