C18H29Cl2IN4O2 — CID 109492719
3-[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide;hydroiodide (PubChem CID 109492719) has the molecular formula C18H29Cl2IN4O2 and a molecular weight of 531.27 g/mol. Its IUPAC name is 3-[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109492719 |
| Molecular Formula | C18H29Cl2IN4O2 |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 3-[[[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-(ethylamino)methylidene]amino]-N-ethyl-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCNC(=O)C(C)(C)C/N=C(\NCC)NCC(O)c1cc(Cl)cc(Cl)c1.I |
| InChI | InChI=1S/C18H28Cl2N4O2.HI/c1-5-21-16(26)18(3,4)11-24-17(22-6-2)23-10-15(25)12-7-13(19)9-14(20)8-12;/h7-9,15,25H,5-6,10-11H2,1-4H3,(H,21,26)(H2,22,23,24);1H |
| InChIKey | JKRYXMDVBFQIDF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|