C20H33FN4O2 — CID 109476115
N-ethyl-3-[[ethylamino-[2-(3-fluorophenoxy)butylamino]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 109476115) has the molecular formula C20H33FN4O2 and a molecular weight of 380.51 g/mol. Its IUPAC name is N-ethyl-3-[[ethylamino-[2-(3-fluorophenoxy)butylamino]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | N-ethyl-3-[[ethylamino-[2-(3-fluorophenoxy)butylamino]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109476115 |
| Molecular Formula | C20H33FN4O2 |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | N-ethyl-3-[[ethylamino-[2-(3-fluorophenoxy)butylamino]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCNC(=O)C(C)(C)C/N=C(\NCC)NCC(CC)Oc1cccc(F)c1 |
| InChI | InChI=1S/C20H33FN4O2/c1-6-16(27-17-11-9-10-15(21)12-17)13-24-19(23-8-3)25-14-20(4,5)18(26)22-7-2/h9-12,16H,6-8,13-14H2,1-5H3,(H,22,26)(H2,23,24,25) |
| InChIKey | LZSSBMPGHPEOQX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|