C19H30FN3O3S — CID 109475501
1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine (PubChem CID 109475501) has the molecular formula C19H30FN3O3S and a molecular weight of 399.53 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 109475501 |
| Molecular Formula | C19H30FN3O3S |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenoxy)butyl]-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CS(C)(=O)=O)CC1)NCC(CC)Oc1cccc(F)c1 |
| InChI | InChI=1S/C19H30FN3O3S/c1-4-16(26-17-8-6-7-15(20)11-17)12-22-18(21-5-2)23-13-19(9-10-19)14-27(3,24)25/h6-8,11,16H,4-5,9-10,12-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | YWTCPBQZKYWWNX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|