C18H27F2N3O4S — CID 109494821
1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine (PubChem CID 109494821) has the molecular formula C18H27F2N3O4S and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 109494821 |
| Molecular Formula | C18H27F2N3O4S |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-3-ethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CS(C)(=O)=O)CC1)NCC(O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H27F2N3O4S/c1-3-21-17(23-11-18(8-9-18)12-28(2,25)26)22-10-15(24)13-4-6-14(7-5-13)27-16(19)20/h4-7,15-16,24H,3,8-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | RXZYFSCKGATSBR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|