C19H31FN4O2 — CID 109476113
N-ethyl-3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-2,2-dimethylpropanamide (PubChem CID 109476113) has the molecular formula C19H31FN4O2 and a molecular weight of 366.48 g/mol. Its IUPAC name is N-ethyl-3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-2,2-dimethylpropanamide.
| Compound Name | N-ethyl-3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 109476113 |
| Molecular Formula | C19H31FN4O2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-ethyl-3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-2,2-dimethylpropanamide |
| SMILES | CCNC(=O)C(C)(C)CN/C(=N\C)NCC(CC)Oc1cccc(F)c1 |
| InChI | InChI=1S/C19H31FN4O2/c1-6-15(26-16-10-8-9-14(20)11-16)12-23-18(21-5)24-13-19(3,4)17(25)22-7-2/h8-11,15H,6-7,12-13H2,1-5H3,(H,22,25)(H2,21,23,24) |
| InChIKey | RXQHWYXHZUUHTG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|