C18H30FIN4O2 — CID 109475442
3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 109475442) has the molecular formula C18H30FIN4O2 and a molecular weight of 480.37 g/mol. Its IUPAC name is 3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109475442 |
| Molecular Formula | C18H30FIN4O2 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N\C)NCC(CC)Oc1cccc(F)c1.I |
| InChI | InChI=1S/C18H29FN4O2.HI/c1-4-10-21-17(24)9-11-22-18(20-3)23-13-15(5-2)25-16-8-6-7-14(19)12-16;/h6-8,12,15H,4-5,9-11,13H2,1-3H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | NNPOEDWFHLUJTC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|