C21H26ClFN4O2 — CID 109475623
2-chloro-N-[2-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 109475623) has the molecular formula C21H26ClFN4O2 and a molecular weight of 420.92 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109475623 |
| Molecular Formula | C21H26ClFN4O2 |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-chloro-N-[2-[[N-[2-(3-fluorophenoxy)butyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCC(CN/C(=N\C)NCCNC(=O)c1ccccc1Cl)Oc1cccc(F)c1 |
| InChI | InChI=1S/C21H26ClFN4O2/c1-3-16(29-17-8-6-7-15(23)13-17)14-27-21(24-2)26-12-11-25-20(28)18-9-4-5-10-19(18)22/h4-10,13,16H,3,11-12,14H2,1-2H3,(H,25,28)(H2,24,26,27) |
| InChIKey | LCWLRZNATBNKGV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|