C17H28Cl2IN3O2S — CID 109492368
1-(2-tert-butylsulfinylethyl)-2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109492368) has the molecular formula C17H28Cl2IN3O2S and a molecular weight of 536.31 g/mol. Its IUPAC name is 1-(2-tert-butylsulfinylethyl)-2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfinylethyl)-2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109492368 |
| Molecular Formula | C17H28Cl2IN3O2S |
| Molecular Weight | 536.31 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | 1-(2-tert-butylsulfinylethyl)-2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCS(=O)C(C)(C)C.I |
| InChI | InChI=1S/C17H27Cl2N3O2S.HI/c1-5-20-16(21-6-7-25(24)17(2,3)4)22-11-15(23)12-8-13(18)10-14(19)9-12;/h8-10,15,23H,5-7,11H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | YJWCDLSSPKJUNK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|