C16H22Cl2F3N3O2 — CID 109492399
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 109492399) has the molecular formula C16H22Cl2F3N3O2 and a molecular weight of 416.27 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 109492399 |
| Molecular Formula | C16H22Cl2F3N3O2 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C16H22Cl2F3N3O2/c1-2-22-15(23-4-3-5-26-10-16(19,20)21)24-9-14(25)11-6-12(17)8-13(18)7-11/h6-8,14,25H,2-5,9-10H2,1H3,(H2,22,23,24) |
| InChIKey | JZTHYEWJQPHESO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|