C17H26Cl2N4O2 — CID 109492351
3-[[N'-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide (PubChem CID 109492351) has the molecular formula C17H26Cl2N4O2 and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-[[N'-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[N'-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 109492351 |
| Molecular Formula | C17H26Cl2N4O2 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[[N'-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCN/C(=N/CC(O)c1cc(Cl)cc(Cl)c1)NCC |
| InChI | InChI=1S/C17H26Cl2N4O2/c1-3-6-21-16(25)5-7-22-17(20-4-2)23-11-15(24)12-8-13(18)10-14(19)9-12/h8-10,15,24H,3-7,11H2,1-2H3,(H,21,25)(H2,20,22,23) |
| InChIKey | ISHPHBHOIGHZQH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|