C20H26Cl2N4O2 — CID 109492197
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 109492197) has the molecular formula C20H26Cl2N4O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 109492197 |
| Molecular Formula | C20H26Cl2N4O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C20H26Cl2N4O2/c1-2-23-20(24-8-4-6-10-26-9-5-3-7-19(26)28)25-14-18(27)15-11-16(21)13-17(22)12-15/h3,5,7,9,11-13,18,27H,2,4,6,8,10,14H2,1H3,(H2,23,24,25) |
| InChIKey | YLHCLCVNEVBBPW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|