C16H26Cl2IN3OS — CID 109492554
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 109492554) has the molecular formula C16H26Cl2IN3OS and a molecular weight of 506.28 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492554 |
| Molecular Formula | C16H26Cl2IN3OS |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCCCSC.I |
| InChI | InChI=1S/C16H25Cl2N3OS.HI/c1-3-19-16(20-6-4-5-7-23-2)21-11-15(22)12-8-13(17)10-14(18)9-12;/h8-10,15,22H,3-7,11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | KWTGBIAASCSTOG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|