C17H28Cl2IN3O2 — CID 109492306
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(5-methoxypentyl)guanidine;hydroiodide (PubChem CID 109492306) has the molecular formula C17H28Cl2IN3O2 and a molecular weight of 504.24 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(5-methoxypentyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(5-methoxypentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492306 |
| Molecular Formula | C17H28Cl2IN3O2 |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-(5-methoxypentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCCCCOC.I |
| InChI | InChI=1S/C17H27Cl2N3O2.HI/c1-3-20-17(21-7-5-4-6-8-24-2)22-12-16(23)13-9-14(18)11-15(19)10-13;/h9-11,16,23H,3-8,12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | ICPXWCJHMMXNIG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|