C20H33Cl2N5O — CID 109492802
2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]guanidine (PubChem CID 109492802) has the molecular formula C20H33Cl2N5O and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 109492802 |
| Molecular Formula | C20H33Cl2N5O |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-methylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(Cl)cc(Cl)c1)NCCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C20H33Cl2N5O/c1-3-23-20(24-6-4-5-7-27-10-8-26(2)9-11-27)25-15-19(28)16-12-17(21)14-18(22)13-16/h12-14,19,28H,3-11,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | JHFBBYKJLDHHEY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|