C18H33ClIN5OS — CID 111702553
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111702553) has the molecular formula C18H33ClIN5OS and a molecular weight of 529.92 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111702553 |
| Molecular Formula | C18H33ClIN5OS |
| Molecular Weight | 529.92 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCCN1CCCN(C)CC1.I |
| InChI | InChI=1S/C18H32ClN5OS.HI/c1-3-20-18(22-14-15(25)16-6-7-17(19)26-16)21-8-4-10-24-11-5-9-23(2)12-13-24;/h6-7,15,25H,3-5,8-14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | VXQXAFRECMZKCH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.92 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|