C23H41N5O — CID 109493055
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 109493055) has the molecular formula C23H41N5O and a molecular weight of 403.62 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109493055 |
| Molecular Formula | C23H41N5O |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.33 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C23H41N5O/c1-6-24-22(25-12-15-28-14-7-13-27(5)16-17-28)26-18-21(29)19-8-10-20(11-9-19)23(2,3)4/h8-11,21,29H,6-7,12-18H2,1-5H3,(H2,24,25,26) |
| InChIKey | XOLGCMHTZHOOGO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|