C20H34N4O2 — CID 109493242
3-[[N'-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 109493242) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 3-[[N'-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N'-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 109493242 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 3-[[N'-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-N-ethylcarbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCC(=O)N(C)C |
| InChI | InChI=1S/C20H34N4O2/c1-7-21-19(22-13-12-18(26)24(5)6)23-14-17(25)15-8-10-16(11-9-15)20(2,3)4/h8-11,17,25H,7,12-14H2,1-6H3,(H2,21,22,23) |
| InChIKey | TUUZGRRVGKXLFL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|