C17H27F2N3O — CID 109493067
1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-2-(2,2-difluoroethyl)-3-ethylguanidine (PubChem CID 109493067) has the molecular formula C17H27F2N3O and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-2-(2,2-difluoroethyl)-3-ethylguanidine.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-2-(2,2-difluoroethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 109493067 |
| Molecular Formula | C17H27F2N3O |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-2-(2,2-difluoroethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(F)F)NCC(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27F2N3O/c1-5-20-16(22-11-15(18)19)21-10-14(23)12-6-8-13(9-7-12)17(2,3)4/h6-9,14-15,23H,5,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | LDMLQGQZQUDHGC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|