C20H34IN3O2 — CID 109493147
1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-methyloxetan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109493147) has the molecular formula C20H34IN3O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-methyloxetan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-methyloxetan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493147 |
| Molecular Formula | C20H34IN3O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethyl-2-[(3-methyloxetan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(C)COC1)NCC(O)c1ccc(C(C)(C)C)cc1.I |
| InChI | InChI=1S/C20H33N3O2.HI/c1-6-21-18(23-12-20(5)13-25-14-20)22-11-17(24)15-7-9-16(10-8-15)19(2,3)4;/h7-10,17,24H,6,11-14H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | MQXIZSRBHOJEPK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|