C18H32IN3OS — CID 109493110
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 109493110) has the molecular formula C18H32IN3OS and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493110 |
| Molecular Formula | C18H32IN3OS |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCSC.I |
| InChI | InChI=1S/C18H31N3OS.HI/c1-6-19-17(20-11-12-23-5)21-13-16(22)14-7-9-15(10-8-14)18(2,3)4;/h7-10,16,22H,6,11-13H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | CIEXUZVEULZIPN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|