C21H34IN5O — CID 109493104
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 109493104) has the molecular formula C21H34IN5O and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109493104 |
| Molecular Formula | C21H34IN5O |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCCn1ccnc1.I |
| InChI | InChI=1S/C21H33N5O.HI/c1-5-23-20(24-11-6-13-26-14-12-22-16-26)25-15-19(27)17-7-9-18(10-8-17)21(2,3)4;/h7-10,12,14,16,19,27H,5-6,11,13,15H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | BXHXHBDWFNMIHQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|