C25H45N5O — CID 109493290
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine (PubChem CID 109493290) has the molecular formula C25H45N5O and a molecular weight of 431.67 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 109493290 |
| Molecular Formula | C25H45N5O |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.36 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C25H45N5O/c1-6-26-24(27-14-8-9-15-30-18-16-29(7-2)17-19-30)28-20-23(31)21-10-12-22(13-11-21)25(3,4)5/h10-13,23,31H,6-9,14-20H2,1-5H3,(H2,26,27,28) |
| InChIKey | FSGIGFGMDCQWRL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|