C15H24N2O2 — CID 111422305
1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethylurea (PubChem CID 111422305) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethylurea.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethylurea |
|---|---|
| PubChem CID | 111422305 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-ethylurea |
| SMILES | CCNC(=O)NCC(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24N2O2/c1-5-16-14(19)17-10-13(18)11-6-8-12(9-7-11)15(2,3)4/h6-9,13,18H,5,10H2,1-4H3,(H2,16,17,19) |
| InChIKey | PELMKIIJQJEWBL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |