C19H28N4O2 — CID 111422275
1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea (PubChem CID 111422275) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea.
| Compound Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 111422275 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
| SMILES | CC(C)n1nccc1NC(=O)NCC(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-13(2)23-17(10-11-21-23)22-18(25)20-12-16(24)14-6-8-15(9-7-14)19(3,4)5/h6-11,13,16,24H,12H2,1-5H3,(H2,20,22,25) |
| InChIKey | VNQSPCQCURZSCK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |