C20H26N2O2S — CID 90582092
1-(4-tert-butylphenyl)-3-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]urea (PubChem CID 90582092) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 90582092 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]urea |
| SMILES | CSc1ccc(C(O)CNC(=O)Nc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-20(2,3)15-7-9-16(10-8-15)22-19(24)21-13-18(23)14-5-11-17(25-4)12-6-14/h5-12,18,23H,13H2,1-4H3,(H2,21,22,24) |
| InChIKey | LDEGFKGEZGDYPD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |