C21H26N2O4 — CID 122021116
4-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122021116) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122021116 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-[[[2-(4-tert-butylphenyl)-2-hydroxyethyl]carbamoylamino]methyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C(O)CNC(=O)NCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)17-10-8-15(9-11-17)18(24)13-23-20(27)22-12-14-4-6-16(7-5-14)19(25)26/h4-11,18,24H,12-13H2,1-3H3,(H,25,26)(H2,22,23,27) |
| InChIKey | KHEFHZOFFPRVSU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |