C16H17FN2O3 — CID 110895643
1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[(4-hydroxyphenyl)methyl]urea (PubChem CID 110895643) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[(4-hydroxyphenyl)methyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[(4-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 110895643 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[(4-hydroxyphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(O)cc1)NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FN2O3/c17-13-5-3-12(4-6-13)15(21)10-19-16(22)18-9-11-1-7-14(20)8-2-11/h1-8,15,20-21H,9-10H2,(H2,18,19,22) |
| InChIKey | NMEGUARKRQZSAG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |