C20H20N2O3 — CID 111111377
1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-hydroxyphenyl)methyl]urea (PubChem CID 111111377) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-hydroxyphenyl)methyl]urea.
| Compound Name | 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 111111377 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-hydroxyphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(O)cc1)NCC(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H20N2O3/c23-18-9-5-14(6-10-18)12-21-20(25)22-13-19(24)17-8-7-15-3-1-2-4-16(15)11-17/h1-11,19,23-24H,12-13H2,(H2,21,22,25) |
| InChIKey | JSKLQRJLSPUSQO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |