C19H16F2N2O2 — CID 111111298
1-(2,6-difluorophenyl)-3-(2-hydroxy-2-naphthalen-2-ylethyl)urea (PubChem CID 111111298) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-naphthalen-2-ylethyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-naphthalen-2-ylethyl)urea |
|---|---|
| PubChem CID | 111111298 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-naphthalen-2-ylethyl)urea |
| SMILES | O=C(NCC(O)c1ccc2ccccc2c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C19H16F2N2O2/c20-15-6-3-7-16(21)18(15)23-19(25)22-11-17(24)14-9-8-12-4-1-2-5-13(12)10-14/h1-10,17,24H,11H2,(H2,22,23,25) |
| InChIKey | BDGATOMUDLWEJU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |