C13H12F2N2O2S — CID 90500402
1-(2,6-difluorophenyl)-3-(2-hydroxy-2-thiophen-2-ylethyl)urea (PubChem CID 90500402) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 90500402 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2-hydroxy-2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCC(O)c1cccs1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H12F2N2O2S/c14-8-3-1-4-9(15)12(8)17-13(19)16-7-10(18)11-5-2-6-20-11/h1-6,10,18H,7H2,(H2,16,17,19) |
| InChIKey | WFNHAAFRKAZVKE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |