C15H13F3N2O2 — CID 110890491
1-(2,6-difluorophenyl)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 110890491) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110890491 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H13F3N2O2/c16-10-6-4-9(5-7-10)13(21)8-19-15(22)20-14-11(17)2-1-3-12(14)18/h1-7,13,21H,8H2,(H2,19,20,22) |
| InChIKey | OYGSMBJRKYDTLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |