C13H13ClN2O2S — CID 95983547
1-(2-chlorophenyl)-3-[(2S)-2-hydroxy-2-thiophen-2-ylethyl]urea (PubChem CID 95983547) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[(2S)-2-hydroxy-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[(2S)-2-hydroxy-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 95983547 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[(2S)-2-hydroxy-2-thiophen-2-ylethyl]urea |
| SMILES | O=C(NC[C@H](O)c1cccs1)Nc1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2O2S/c14-9-4-1-2-5-10(9)16-13(18)15-8-11(17)12-6-3-7-19-12/h1-7,11,17H,8H2,(H2,15,16,18)/t11-/m0/s1 |
| InChIKey | JUZVSYXWNNQOBA-NSHDSACASA-N |
| XLogP | 3.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |