C15H15ClN2O3S — CID 90524242
N'-(2-chlorophenyl)-N-(3-hydroxy-3-thiophen-2-ylpropyl)oxamide (PubChem CID 90524242) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-(3-hydroxy-3-thiophen-2-ylpropyl)oxamide.
| Compound Name | N'-(2-chlorophenyl)-N-(3-hydroxy-3-thiophen-2-ylpropyl)oxamide |
|---|---|
| PubChem CID | 90524242 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N'-(2-chlorophenyl)-N-(3-hydroxy-3-thiophen-2-ylpropyl)oxamide |
| SMILES | O=C(NCCC(O)c1cccs1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN2O3S/c16-10-4-1-2-5-11(10)18-15(21)14(20)17-8-7-12(19)13-6-3-9-22-13/h1-6,9,12,19H,7-8H2,(H,17,20)(H,18,21) |
| InChIKey | ZSMVNJGBKQYCAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|