C24H24N2O4 — CID 86903823
1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea (PubChem CID 86903823) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea.
| Compound Name | 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 86903823 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-(2-hydroxy-2-naphthalen-2-ylethyl)-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea |
| SMILES | C#CCOc1cc(CNC(=O)NCC(O)c2ccc3ccccc3c2)ccc1OC |
| InChI | InChI=1S/C24H24N2O4/c1-3-12-30-23-13-17(8-11-22(23)29-2)15-25-24(28)26-16-21(27)20-10-9-18-6-4-5-7-19(18)14-20/h1,4-11,13-14,21,27H,12,15-16H2,2H3,(H2,25,26,28) |
| InChIKey | MSGBLZJLMBMGEF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|