C21H24N2O5 — CID 90575695
1-[(3,4-dimethoxyphenyl)methyl]-3-[4-(2-methoxyphenoxy)but-2-ynyl]urea (PubChem CID 90575695) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[4-(2-methoxyphenoxy)but-2-ynyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[4-(2-methoxyphenoxy)but-2-ynyl]urea |
|---|---|
| PubChem CID | 90575695 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[4-(2-methoxyphenoxy)but-2-ynyl]urea |
| SMILES | COc1ccc(CNC(=O)NCC#CCOc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C21H24N2O5/c1-25-17-8-4-5-9-19(17)28-13-7-6-12-22-21(24)23-15-16-10-11-18(26-2)20(14-16)27-3/h4-5,8-11,14H,12-13,15H2,1-3H3,(H2,22,23,24) |
| InChIKey | CCARZUPQOHFFKI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|