C22H22N2O4 — CID 52593579
1-[(3,4-dimethoxyphenyl)methyl]-3-(2-phenoxyphenyl)urea (PubChem CID 52593579) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-phenoxyphenyl)urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 52593579 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-phenoxyphenyl)urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccccc2Oc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H22N2O4/c1-26-20-13-12-16(14-21(20)27-2)15-23-22(25)24-18-10-6-7-11-19(18)28-17-8-4-3-5-9-17/h3-14H,15H2,1-2H3,(H2,23,24,25) |
| InChIKey | RRURPRIBSWVNGL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |