C15H14Cl2N2O2 — CID 3844619
1-[(3,4-dichlorophenyl)methyl]-3-(2-methoxyphenyl)urea (PubChem CID 3844619) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 3844619 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-21-14-5-3-2-4-13(14)19-15(20)18-9-10-6-7-11(16)12(17)8-10/h2-8H,9H2,1H3,(H2,18,19,20) |
| InChIKey | XDVAAWHAUIOBIB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |