C17H17Cl2NO4S — CID 51946841
(2R)-2-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-methoxyphenyl)propanamide (PubChem CID 51946841) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is (2R)-2-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-methoxyphenyl)propanamide.
| Compound Name | (2R)-2-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51946841 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (2R)-2-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1NC(=O)[C@@H](C)S(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-11(17(21)20-15-5-3-4-6-16(15)24-2)25(22,23)10-12-7-8-13(18)14(19)9-12/h3-9,11H,10H2,1-2H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | WNWMNJFDIZQXAQ-LLVKDONJSA-N |
| XLogP | 3.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |