C16H16Cl2N2O4S — CID 126035617
2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-methoxyphenyl)acetamide (PubChem CID 126035617) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126035617 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-24-15-6-4-3-5-14(15)19-16(21)10-20(25(2,22)23)11-7-8-12(17)13(18)9-11/h3-9H,10H2,1-2H3,(H,19,21) |
| InChIKey | ZAATYHPMEOLUSY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |